Urolithin B (1139-83-9 factory Ifektri yomkhiqizi

I-Urolithin B

November 9, 2020

I-Urolithin BSiziqu

Igama: I-Urolithin B
Chemical igama: I-3-Hydroxy-6H-dibenzo [b, d] pyran-6-eyodwa
CAS: 1139-83-9
Indlela yamakhemikhali: C13H8O3
Isisindo somzimba: I-212.2 g / mol
Umbala:  powder emhlophe
Ukhiye we-InChi: I-WXUQMTRHPNOXBV-UHFFFAOYSA-N
Amakhodi we-SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
umsebenzi: I-Urolithin B ingathuthukisa ukusebenza kwe-mitochondrial kanye nemisipha.

I-Urolithin B ingathuthukisa amandla emisipha nokukhuthazela ngesikhathi sokuguga.

Isicelo: I-Urolithin B iyi-metabolite yama-bacterial sebacterial ye-ellagitannis futhi ikhombisa ukusebenza okunamandla okulwa ne-oxidant kanye ne-pro-oxidant ngokuya ngohlelo nemibandela yokulinganisa. I-Urolithin B nayo ingabonisa umsebenzi we-estrogenic kanye / noma wokulwa ne-estrogenic.
Umswakama: I-soluble kalula ku-N, N-dimethylformamide ne-dimethylmethylene. I-Sulfone, inyibilika kancane kwi-methanol, ethanol, ne-ethyl acetate
Isitoreji Sokugcina: I-Hygroscopic, i-20 ° C I-Freezer, Ngaphansi kwesimo sokungena
Isimo Sokuthumela: Kuthunyelwe ngaphansi kokushisa okumangalisayo njengamakhemikhali angenabungozi. Lo mkhiqizo uzinzile ngokwanele amasonto ambalwa ngesikhathi sokuthunyelwa okujwayelekile kanye nesikhathi esetshenziswa ku-Customs.